About N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine
N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine (PubChem CID 65239951) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine |
| PubChem CID | 65239951 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cnoc1C1CC1 |
| InChI | InChI=1S/C11H18N2O/c1-8(2)5-12-6-10-7-13-14-11(10)9-3-4-9/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | JOAKALHSEBDMDB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine (CID 65239951) is N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine is CC(C)CNCc1cnoc1C1CC1.
What is the InChIKey of N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine?
The InChIKey is JOAKALHSEBDMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-8(2)5-12-6-10-7-13-14-11(10)9-3-4-9/h7-9,12H,3-6H2,1-2H3.
What are the key properties of N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine?
N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine has a molecular weight of 194.28 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 65239951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).