C15H11N3O3S — CID 652401
N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 652401) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 652401 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nccs1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C15H11N3O3S/c19-13(18-15-16-7-9-22-15)10-3-5-11(6-4-10)17-14(20)12-2-1-8-21-12/h1-9H,(H,17,20)(H,16,18,19) |
| InChIKey | OAVQGDUZVDBKKR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |