About 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile
3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile (PubChem CID 65240144) has the molecular formula C11H7ClN2O
and a molecular weight of 218.64 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile |
| PubChem CID | 65240144 |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2oncc2CCl)c1 |
| InChI | InChI=1S/C11H7ClN2O/c12-5-10-7-14-15-11(10)9-3-1-2-8(4-9)6-13/h1-4,7H,5H2 |
| InChIKey | SOHGLGPAIGZNES-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile?
The IUPAC name of 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile (CID 65240144) is 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile.
What is the SMILES notation for 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile?
The canonical SMILES for 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile is N#Cc1cccc(-c2oncc2CCl)c1.
What is the InChIKey of 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile?
The InChIKey is SOHGLGPAIGZNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN2O/c12-5-10-7-14-15-11(10)9-3-1-2-8(4-9)6-13/h1-4,7H,5H2.
What are the key properties of 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile?
3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile has a molecular weight of 218.64 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(chloromethyl)-1,2-oxazol-5-yl]benzonitrile is sourced from PubChem (CID 65240144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).