About 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole
4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole (PubChem CID 65240257) has the molecular formula C10H6Cl3NO
and a molecular weight of 262.52 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole |
| PubChem CID | 65240257 |
| Molecular Formula | C10H6Cl3NO |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole |
| SMILES | ClCc1cnoc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H6Cl3NO/c11-4-6-5-14-15-10(6)8-2-1-7(12)3-9(8)13/h1-3,5H,4H2 |
| InChIKey | RLMJHMPHVOSHOT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole?
The IUPAC name of 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole (CID 65240257) is 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole.
What is the SMILES notation for 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole?
The canonical SMILES for 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole is ClCc1cnoc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole?
The InChIKey is RLMJHMPHVOSHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl3NO/c11-4-6-5-14-15-10(6)8-2-1-7(12)3-9(8)13/h1-3,5H,4H2.
What are the key properties of 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole?
4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole has a molecular weight of 262.52 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-5-(2,4-dichlorophenyl)-1,2-oxazole is sourced from PubChem (CID 65240257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).