About N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine
N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65240284) has the molecular formula C14H16Cl2N2O
and a molecular weight of 299.20 g/mol. Its IUPAC name is N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 65240284 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnoc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O/c1-14(2,3)17-7-10-8-18-19-13(10)9-4-5-11(15)12(16)6-9/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | FSWNYCXCPNOCAQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine (CID 65240284) is N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1cnoc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine?
The InChIKey is FSWNYCXCPNOCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O/c1-14(2,3)17-7-10-8-18-19-13(10)9-4-5-11(15)12(16)6-9/h4-6,8,17H,7H2,1-3H3.
What are the key properties of N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine?
N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine has a molecular weight of 299.20 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(3,4-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 65240284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).