C12H20N2OS — CID 65241174
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(propylamino)acetamide (PubChem CID 65241174) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(propylamino)acetamide.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(propylamino)acetamide |
|---|---|
| PubChem CID | 65241174 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(propylamino)acetamide |
| SMILES | CCCNCC(=O)NCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-4-5-13-8-12(15)14-7-11-6-9(2)10(3)16-11/h6,13H,4-5,7-8H2,1-3H3,(H,14,15) |
| InChIKey | VRCJLOLUDZHFPR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|