About 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine
2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine (PubChem CID 65241356) has the molecular formula C14H24N2S
and a molecular weight of 252.43 g/mol. Its IUPAC name is 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine |
| PubChem CID | 65241356 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine |
| SMILES | Cc1cc(CNCC2CCCCC2N)sc1C |
| InChI | InChI=1S/C14H24N2S/c1-10-7-13(17-11(10)2)9-16-8-12-5-3-4-6-14(12)15/h7,12,14,16H,3-6,8-9,15H2,1-2H3 |
| InChIKey | NNOBGFOBKLJHQP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine?
The IUPAC name of 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine (CID 65241356) is 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine.
What is the SMILES notation for 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine?
The canonical SMILES for 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine is Cc1cc(CNCC2CCCCC2N)sc1C.
What is the InChIKey of 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine?
The InChIKey is NNOBGFOBKLJHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S/c1-10-7-13(17-11(10)2)9-16-8-12-5-3-4-6-14(12)15/h7,12,14,16H,3-6,8-9,15H2,1-2H3.
What are the key properties of 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine?
2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine has a molecular weight of 252.43 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]cyclohexan-1-amine is sourced from PubChem (CID 65241356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).