About 3-hexoxyaniline
3-hexoxyaniline (PubChem CID 652414) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-hexoxyaniline.
Molecular Properties
| Compound Name | 3-hexoxyaniline |
| PubChem CID | 652414 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-hexoxyaniline |
| SMILES | CCCCCCOc1cccc(N)c1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-9-14-12-8-6-7-11(13)10-12/h6-8,10H,2-5,9,13H2,1H3 |
| InChIKey | NFUUFPNUOVKOIG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxyaniline?
The IUPAC name of 3-hexoxyaniline (CID 652414) is 3-hexoxyaniline.
What is the SMILES notation for 3-hexoxyaniline?
The canonical SMILES for 3-hexoxyaniline is CCCCCCOc1cccc(N)c1.
What is the InChIKey of 3-hexoxyaniline?
The InChIKey is NFUUFPNUOVKOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-2-3-4-5-9-14-12-8-6-7-11(13)10-12/h6-8,10H,2-5,9,13H2,1H3.
What are the key properties of 3-hexoxyaniline?
3-hexoxyaniline has a molecular weight of 193.29 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxyaniline is sourced from PubChem (CID 652414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).