About 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide
3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 65243704) has the molecular formula C13H12Cl2N2OS
and a molecular weight of 315.23 g/mol. Its IUPAC name is 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide |
| PubChem CID | 65243704 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2nc(Cl)ccc2Cl)sc1C |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-7-5-9(19-8(7)2)6-16-13(18)12-10(14)3-4-11(15)17-12/h3-5H,6H2,1-2H3,(H,16,18) |
| InChIKey | ALTPYHAGDALLEA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide?
The IUPAC name of 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide (CID 65243704) is 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide.
What is the SMILES notation for 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide?
The canonical SMILES for 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide is Cc1cc(CNC(=O)c2nc(Cl)ccc2Cl)sc1C.
What is the InChIKey of 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide?
The InChIKey is ALTPYHAGDALLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2OS/c1-7-5-9(19-8(7)2)6-16-13(18)12-10(14)3-4-11(15)17-12/h3-5H,6H2,1-2H3,(H,16,18).
What are the key properties of 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide?
3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide has a molecular weight of 315.23 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-2-carboxamide is sourced from PubChem (CID 65243704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).