About 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide
2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide (PubChem CID 65244056) has the molecular formula C12H16N2OS
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide |
| PubChem CID | 65244056 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide |
| SMILES | Cc1cc(CNC(=O)C(C)(C)C#N)sc1C |
| InChI | InChI=1S/C12H16N2OS/c1-8-5-10(16-9(8)2)6-14-11(15)12(3,4)7-13/h5H,6H2,1-4H3,(H,14,15) |
| InChIKey | GMGFNDFYWIWQJX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide?
The IUPAC name of 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide (CID 65244056) is 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide.
What is the SMILES notation for 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide?
The canonical SMILES for 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide is Cc1cc(CNC(=O)C(C)(C)C#N)sc1C.
What is the InChIKey of 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide?
The InChIKey is GMGFNDFYWIWQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OS/c1-8-5-10(16-9(8)2)6-14-11(15)12(3,4)7-13/h5H,6H2,1-4H3,(H,14,15).
What are the key properties of 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide?
2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide has a molecular weight of 236.34 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(4,5-dimethylthiophen-2-yl)methyl]-2-methylpropanamide is sourced from PubChem (CID 65244056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).