C13H17N3O3S — CID 65244298
1-[6-(3-aminoazetidin-1-yl)sulfonyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 65244298) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[6-(3-aminoazetidin-1-yl)sulfonyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[6-(3-aminoazetidin-1-yl)sulfonyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 65244298 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[6-(3-aminoazetidin-1-yl)sulfonyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2ccc(S(=O)(=O)N3CC(N)C3)cc21 |
| InChI | InChI=1S/C13H17N3O3S/c1-9(17)16-5-4-10-2-3-12(6-13(10)16)20(18,19)15-7-11(14)8-15/h2-3,6,11H,4-5,7-8,14H2,1H3 |
| InChIKey | RGDSHTQWLSVEEZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |