C11H22N4O2 — CID 65245071
2-(3-aminoazetidin-1-yl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]acetamide (PubChem CID 65245071) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(3-aminoazetidin-1-yl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]acetamide.
| Compound Name | 2-(3-aminoazetidin-1-yl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 65245071 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-(3-aminoazetidin-1-yl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]acetamide |
| SMILES | CCCNC(=O)CN(C)C(=O)CN1CC(N)C1 |
| InChI | InChI=1S/C11H22N4O2/c1-3-4-13-10(16)7-14(2)11(17)8-15-5-9(12)6-15/h9H,3-8,12H2,1-2H3,(H,13,16) |
| InChIKey | LKWPTGWLRRDQRT-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |