About 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione
6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 65245633) has the molecular formula C14H13BrN2S2
and a molecular weight of 353.31 g/mol. Its IUPAC name is 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione |
| PubChem CID | 65245633 |
| Molecular Formula | C14H13BrN2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1cc(Cn2c(=S)[nH]c3cc(Br)ccc32)sc1C |
| InChI | InChI=1S/C14H13BrN2S2/c1-8-5-11(19-9(8)2)7-17-13-4-3-10(15)6-12(13)16-14(17)18/h3-6H,7H2,1-2H3,(H,16,18) |
| InChIKey | CBOGLQPTJHYQKS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione?
The IUPAC name of 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione (CID 65245633) is 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione.
What is the SMILES notation for 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione?
The canonical SMILES for 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione is Cc1cc(Cn2c(=S)[nH]c3cc(Br)ccc32)sc1C.
What is the InChIKey of 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione?
The InChIKey is CBOGLQPTJHYQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2S2/c1-8-5-11(19-9(8)2)7-17-13-4-3-10(15)6-12(13)16-14(17)18/h3-6H,7H2,1-2H3,(H,16,18).
What are the key properties of 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione?
6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione has a molecular weight of 353.31 g/mol, XLogP of 5.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(4,5-dimethylthiophen-2-yl)methyl]-1H-benzimidazole-2-thione is sourced from PubChem (CID 65245633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).