About 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine
3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine (PubChem CID 65245690) has the molecular formula C11H12ClN3S
and a molecular weight of 253.76 g/mol. Its IUPAC name is 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine |
| PubChem CID | 65245690 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine |
| SMILES | Cc1cc(CNc2nccnc2Cl)sc1C |
| InChI | InChI=1S/C11H12ClN3S/c1-7-5-9(16-8(7)2)6-15-11-10(12)13-3-4-14-11/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | BEAPGPZACMPGFF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine?
The IUPAC name of 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine (CID 65245690) is 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine.
What is the SMILES notation for 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine?
The canonical SMILES for 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine is Cc1cc(CNc2nccnc2Cl)sc1C.
What is the InChIKey of 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine?
The InChIKey is BEAPGPZACMPGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3S/c1-7-5-9(16-8(7)2)6-15-11-10(12)13-3-4-14-11/h3-5H,6H2,1-2H3,(H,14,15).
What are the key properties of 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine?
3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine has a molecular weight of 253.76 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]pyrazin-2-amine is sourced from PubChem (CID 65245690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).