About 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane
9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane (PubChem CID 65245766) has the molecular formula C15H24N2S
and a molecular weight of 264.44 g/mol. Its IUPAC name is 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane |
| PubChem CID | 65245766 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane |
| SMILES | Cc1cc(CN2CCNC3(CCCC3)C2)sc1C |
| InChI | InChI=1S/C15H24N2S/c1-12-9-14(18-13(12)2)10-17-8-7-16-15(11-17)5-3-4-6-15/h9,16H,3-8,10-11H2,1-2H3 |
| InChIKey | DGCOUIKYLRXSBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane?
The IUPAC name of 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane (CID 65245766) is 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane is Cc1cc(CN2CCNC3(CCCC3)C2)sc1C.
What is the InChIKey of 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane?
The InChIKey is DGCOUIKYLRXSBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2S/c1-12-9-14(18-13(12)2)10-17-8-7-16-15(11-17)5-3-4-6-15/h9,16H,3-8,10-11H2,1-2H3.
What are the key properties of 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane?
9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane has a molecular weight of 264.44 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(4,5-dimethylthiophen-2-yl)methyl]-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 65245766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).