C15H19FN2OS — CID 65246084
2-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-ethoxy-5-fluorobenzene-1,2-diamine (PubChem CID 65246084) has the molecular formula C15H19FN2OS and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-ethoxy-5-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-ethoxy-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 65246084 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]-4-ethoxy-5-fluorobenzene-1,2-diamine |
| SMILES | CCOc1cc(NCc2cc(C)c(C)s2)c(N)cc1F |
| InChI | InChI=1S/C15H19FN2OS/c1-4-19-15-7-14(13(17)6-12(15)16)18-8-11-5-9(2)10(3)20-11/h5-7,18H,4,8,17H2,1-3H3 |
| InChIKey | YJDBOMXXFKGESD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|