C12H19NS2 — CID 65246378
N-[(4,5-dimethylthiophen-2-yl)methyl]thian-4-amine (PubChem CID 65246378) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]thian-4-amine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 65246378 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]thian-4-amine |
| SMILES | Cc1cc(CNC2CCSCC2)sc1C |
| InChI | InChI=1S/C12H19NS2/c1-9-7-12(15-10(9)2)8-13-11-3-5-14-6-4-11/h7,11,13H,3-6,8H2,1-2H3 |
| InChIKey | PYOFFBDPNIVMSX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |