About 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide
1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide (PubChem CID 65247183) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide |
| PubChem CID | 65247183 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(CCN1CCCC1C(N)=O)C(N)=S |
| InChI | InChI=1S/C11H21N3OS/c1-11(2,10(13)16)5-7-14-6-3-4-8(14)9(12)15/h8H,3-7H2,1-2H3,(H2,12,15)(H2,13,16) |
| InChIKey | JJDAOSPQIMJUKJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide?
The IUPAC name of 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide (CID 65247183) is 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide?
The canonical SMILES for 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide is CC(C)(CCN1CCCC1C(N)=O)C(N)=S.
What is the InChIKey of 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide?
The InChIKey is JJDAOSPQIMJUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-11(2,10(13)16)5-7-14-6-3-4-8(14)9(12)15/h8H,3-7H2,1-2H3,(H2,12,15)(H2,13,16).
What are the key properties of 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide?
1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide has a molecular weight of 243.38 g/mol, XLogP of 0.64, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3,3-dimethyl-4-sulfanylidenebutyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 65247183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).