C9H17F3N2S — CID 65247350
2,2-dimethyl-4-[methyl(2,2,2-trifluoroethyl)amino]butanethioamide (PubChem CID 65247350) has the molecular formula C9H17F3N2S and a molecular weight of 242.31 g/mol. Its IUPAC name is 2,2-dimethyl-4-[methyl(2,2,2-trifluoroethyl)amino]butanethioamide.
| Compound Name | 2,2-dimethyl-4-[methyl(2,2,2-trifluoroethyl)amino]butanethioamide |
|---|---|
| PubChem CID | 65247350 |
| Molecular Formula | C9H17F3N2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2,2-dimethyl-4-[methyl(2,2,2-trifluoroethyl)amino]butanethioamide |
| SMILES | CN(CCC(C)(C)C(N)=S)CC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2S/c1-8(2,7(13)15)4-5-14(3)6-9(10,11)12/h4-6H2,1-3H3,(H2,13,15) |
| InChIKey | GSUGBLZKTHKQTR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|