C23H23FN2O5 — CID 652474
methyl 5-ethyl-1-(2-fluorophenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 652474) has the molecular formula C23H23FN2O5 and a molecular weight of 426.44 g/mol. Its IUPAC name is methyl 5-ethyl-1-(2-fluorophenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl 5-ethyl-1-(2-fluorophenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 652474 |
| Molecular Formula | C23H23FN2O5 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | methyl 5-ethyl-1-(2-fluorophenyl)-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)C2C(c3ccccc3F)NC(Cc3ccc(O)cc3)(C(=O)OC)C2C1=O |
| InChI | InChI=1S/C23H23FN2O5/c1-3-26-20(28)17-18(21(26)29)23(22(30)31-2,12-13-8-10-14(27)11-9-13)25-19(17)15-6-4-5-7-16(15)24/h4-11,17-19,25,27H,3,12H2,1-2H3 |
| InChIKey | DVARYMCFDJNTDD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|