C22H28N4O4 — CID 652478
N-[2,5-dimethoxy-4-(phenylcarbamoylamino)phenyl]-2-piperidin-1-ylacetamide (PubChem CID 652478) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-(phenylcarbamoylamino)phenyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-[2,5-dimethoxy-4-(phenylcarbamoylamino)phenyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 652478 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[2,5-dimethoxy-4-(phenylcarbamoylamino)phenyl]-2-piperidin-1-ylacetamide |
| SMILES | COc1cc(NC(=O)Nc2ccccc2)c(OC)cc1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C22H28N4O4/c1-29-19-14-18(25-22(28)23-16-9-5-3-6-10-16)20(30-2)13-17(19)24-21(27)15-26-11-7-4-8-12-26/h3,5-6,9-10,13-14H,4,7-8,11-12,15H2,1-2H3,(H,24,27)(H2,23,25,28) |
| InChIKey | ZYPTVUFGLWEFFM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |