About 4-cycloheptyloxy-2,2-dimethylbutanethioamide
4-cycloheptyloxy-2,2-dimethylbutanethioamide (PubChem CID 65247901) has the molecular formula C13H25NOS
and a molecular weight of 243.42 g/mol. Its IUPAC name is 4-cycloheptyloxy-2,2-dimethylbutanethioamide.
Molecular Properties
| Compound Name | 4-cycloheptyloxy-2,2-dimethylbutanethioamide |
| PubChem CID | 65247901 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-cycloheptyloxy-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCOC1CCCCCC1)C(N)=S |
| InChI | InChI=1S/C13H25NOS/c1-13(2,12(14)16)9-10-15-11-7-5-3-4-6-8-11/h11H,3-10H2,1-2H3,(H2,14,16) |
| InChIKey | CGTCAIDWCQWHKF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-cycloheptyloxy-2,2-dimethylbutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cycloheptyloxy-2,2-dimethylbutanethioamide?
The IUPAC name of 4-cycloheptyloxy-2,2-dimethylbutanethioamide (CID 65247901) is 4-cycloheptyloxy-2,2-dimethylbutanethioamide.
What is the SMILES notation for 4-cycloheptyloxy-2,2-dimethylbutanethioamide?
The canonical SMILES for 4-cycloheptyloxy-2,2-dimethylbutanethioamide is CC(C)(CCOC1CCCCCC1)C(N)=S.
What is the InChIKey of 4-cycloheptyloxy-2,2-dimethylbutanethioamide?
The InChIKey is CGTCAIDWCQWHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NOS/c1-13(2,12(14)16)9-10-15-11-7-5-3-4-6-8-11/h11H,3-10H2,1-2H3,(H2,14,16).
What are the key properties of 4-cycloheptyloxy-2,2-dimethylbutanethioamide?
4-cycloheptyloxy-2,2-dimethylbutanethioamide has a molecular weight of 243.42 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cycloheptyloxy-2,2-dimethylbutanethioamide is sourced from PubChem (CID 65247901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).