C13H21NO3 — CID 65248066
4-[ethyl(furan-2-ylmethyl)amino]-2,2-dimethylbutanoic acid (PubChem CID 65248066) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[ethyl(furan-2-ylmethyl)amino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[ethyl(furan-2-ylmethyl)amino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65248066 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[ethyl(furan-2-ylmethyl)amino]-2,2-dimethylbutanoic acid |
| SMILES | CCN(CCC(C)(C)C(=O)O)Cc1ccco1 |
| InChI | InChI=1S/C13H21NO3/c1-4-14(10-11-6-5-9-17-11)8-7-13(2,3)12(15)16/h5-6,9H,4,7-8,10H2,1-3H3,(H,15,16) |
| InChIKey | CVAZJHWDANHHTD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |