About 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid
4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid (PubChem CID 65248075) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid |
| PubChem CID | 65248075 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid |
| SMILES | Cc1cc(C)n(CCC(C)(C)C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C12H18N2O3/c1-8-7-9(2)14(11(17)13-8)6-5-12(3,4)10(15)16/h7H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | SMXBGPKDWKHKQE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid?
The IUPAC name of 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid (CID 65248075) is 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid is Cc1cc(C)n(CCC(C)(C)C(=O)O)c(=O)n1.
What is the InChIKey of 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid?
The InChIKey is SMXBGPKDWKHKQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-8-7-9(2)14(11(17)13-8)6-5-12(3,4)10(15)16/h7H,5-6H2,1-4H3,(H,15,16).
What are the key properties of 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid?
4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid has a molecular weight of 238.29 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylbutanoic acid is sourced from PubChem (CID 65248075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).