C10H19F3N2S — CID 65248681
4-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylbutanethioamide (PubChem CID 65248681) has the molecular formula C10H19F3N2S and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65248681 |
| Molecular Formula | C10H19F3N2S |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylbutanethioamide |
| SMILES | CCN(CCC(C)(C)C(N)=S)CC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2S/c1-4-15(7-10(11,12)13)6-5-9(2,3)8(14)16/h4-7H2,1-3H3,(H2,14,16) |
| InChIKey | KPKBCYNUWNDGHI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|