C12H19N3O2S — CID 65248826
4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanethioamide (PubChem CID 65248826) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65248826 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-2,2-dimethylbutanethioamide |
| SMILES | Cc1c(C)c(=O)n(CCC(C)(C)C(N)=S)[nH]c1=O |
| InChI | InChI=1S/C12H19N3O2S/c1-7-8(2)10(17)15(14-9(7)16)6-5-12(3,4)11(13)18/h5-6H2,1-4H3,(H2,13,18)(H,14,16) |
| InChIKey | FCKFIBBJRFAKOT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|