C11H21F3N2S — CID 65248857
2,2-dimethyl-4-[propyl(2,2,2-trifluoroethyl)amino]butanethioamide (PubChem CID 65248857) has the molecular formula C11H21F3N2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2,2-dimethyl-4-[propyl(2,2,2-trifluoroethyl)amino]butanethioamide.
| Compound Name | 2,2-dimethyl-4-[propyl(2,2,2-trifluoroethyl)amino]butanethioamide |
|---|---|
| PubChem CID | 65248857 |
| Molecular Formula | C11H21F3N2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2,2-dimethyl-4-[propyl(2,2,2-trifluoroethyl)amino]butanethioamide |
| SMILES | CCCN(CCC(C)(C)C(N)=S)CC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2S/c1-4-6-16(8-11(12,13)14)7-5-10(2,3)9(15)17/h4-8H2,1-3H3,(H2,15,17) |
| InChIKey | IZHHPYLPBXOQAL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|