About 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile
4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile (PubChem CID 65249068) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile |
| PubChem CID | 65249068 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCNCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O2S/c1-11(2,9-12)4-5-13-7-10-3-6-16(14,15)8-10/h10,13H,3-8H2,1-2H3 |
| InChIKey | VATLSVRLDKYMNZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile (CID 65249068) is 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile is CC(C)(C#N)CCNCC1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile?
The InChIKey is VATLSVRLDKYMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2S/c1-11(2,9-12)4-5-13-7-10-3-6-16(14,15)8-10/h10,13H,3-8H2,1-2H3.
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile?
4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile has a molecular weight of 244.36 g/mol, XLogP of 0.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethylbutanenitrile is sourced from PubChem (CID 65249068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).