C13H27N3S — CID 65249097
2,2-dimethyl-4-(3,3,4-trimethylpiperazin-1-yl)butanethioamide (PubChem CID 65249097) has the molecular formula C13H27N3S and a molecular weight of 257.45 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3,3,4-trimethylpiperazin-1-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(3,3,4-trimethylpiperazin-1-yl)butanethioamide |
|---|---|
| PubChem CID | 65249097 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2,2-dimethyl-4-(3,3,4-trimethylpiperazin-1-yl)butanethioamide |
| SMILES | CN1CCN(CCC(C)(C)C(N)=S)CC1(C)C |
| InChI | InChI=1S/C13H27N3S/c1-12(2,11(14)17)6-7-16-9-8-15(5)13(3,4)10-16/h6-10H2,1-5H3,(H2,14,17) |
| InChIKey | ZVLSKDHBUYBVEZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|