About 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine
1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine (PubChem CID 65250257) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine.
Analyze 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine?
The IUPAC name of 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine (CID 65250257) is 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine.
What is the SMILES notation for 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine?
The canonical SMILES for 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine is Cc1cc(CN2CC(N)C2)no1.
What is the InChIKey of 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine?
The InChIKey is PJDJYQPKOSHPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-6-2-8(10-12-6)5-11-3-7(9)4-11/h2,7H,3-5,9H2,1H3.
What are the key properties of 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine?
1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine has a molecular weight of 167.21 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1,2-oxazol-3-yl)methyl]azetidin-3-amine is sourced from PubChem (CID 65250257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).