About 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile
4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile (PubChem CID 65251141) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile |
| PubChem CID | 65251141 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCN1CC(CCN)c2ccccc21 |
| InChI | InChI=1S/C16H23N3/c1-16(2,12-18)8-10-19-11-13(7-9-17)14-5-3-4-6-15(14)19/h3-6,13H,7-11,17H2,1-2H3 |
| InChIKey | YNRVNBWYXNGGGQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile?
The IUPAC name of 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile (CID 65251141) is 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile is CC(C)(C#N)CCN1CC(CCN)c2ccccc21.
What is the InChIKey of 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile?
The InChIKey is YNRVNBWYXNGGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-16(2,12-18)8-10-19-11-13(7-9-17)14-5-3-4-6-15(14)19/h3-6,13H,7-11,17H2,1-2H3.
What are the key properties of 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile?
4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile has a molecular weight of 257.38 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-aminoethyl)-2,3-dihydroindol-1-yl]-2,2-dimethylbutanenitrile is sourced from PubChem (CID 65251141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).