C28H22Cl2N2O3 — CID 6525173
4-chloro-N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-oxo-3-(1-phenylethylamino)prop-1-en-2-yl]benzamide (PubChem CID 6525173) has the molecular formula C28H22Cl2N2O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-oxo-3-(1-phenylethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-oxo-3-(1-phenylethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6525173 |
| Molecular Formula | C28H22Cl2N2O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-chloro-N-[(Z)-1-[5-(4-chlorophenyl)furan-2-yl]-3-oxo-3-(1-phenylethylamino)prop-1-en-2-yl]benzamide |
| SMILES | CC(NC(=O)/C(=C/c1ccc(-c2ccc(Cl)cc2)o1)NC(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H22Cl2N2O3/c1-18(19-5-3-2-4-6-19)31-28(34)25(32-27(33)21-9-13-23(30)14-10-21)17-24-15-16-26(35-24)20-7-11-22(29)12-8-20/h2-18H,1H3,(H,31,34)(H,32,33)/b25-17- |
| InChIKey | QBTVOIBJZWZRSW-UQQQWYQISA-N |
| XLogP | 6.90 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|