C8H15N5S — CID 65251853
2,2-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)butanimidamide (PubChem CID 65251853) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)butanimidamide.
| Compound Name | 2,2-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 65251853 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2,2-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanyl)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSc1ncn[nH]1 |
| InChI | InChI=1S/C8H15N5S/c1-8(2,6(9)10)3-4-14-7-11-5-12-13-7/h5H,3-4H2,1-2H3,(H3,9,10)(H,11,12,13) |
| InChIKey | VBQSTTXQUZNDMM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|