About (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine
(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 6525197) has the molecular formula C9H11ClN4O2
and a molecular weight of 242.67 g/mol. Its IUPAC name is (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| PubChem CID | 6525197 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C\[N+](=O)[O-])NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H11ClN4O2/c1-11-9(6-14(15)16)13-5-7-2-3-8(10)12-4-7/h2-4,6,11,13H,5H2,1H3/b9-6+ |
| InChIKey | HVEUAXZJMGUHAT-RMKNXTFCSA-N |
| XLogP | 1.12 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The IUPAC name of (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine (CID 6525197) is (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine.
What is the SMILES notation for (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The canonical SMILES for (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine is CN/C(=C\[N+](=O)[O-])NCc1ccc(Cl)nc1.
What is the InChIKey of (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The InChIKey is HVEUAXZJMGUHAT-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H11ClN4O2/c1-11-9(6-14(15)16)13-5-7-2-3-8(10)12-4-7/h2-4,6,11,13H,5H2,1H3/b9-6+.
What are the key properties of (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine has a molecular weight of 242.67 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine is sourced from PubChem (CID 6525197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).