About 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide
4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide (PubChem CID 65252117) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide |
| PubChem CID | 65252117 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN(C)C(C)C1CC1 |
| InChI | InChI=1S/C12H25N3/c1-9(10-5-6-10)15(4)8-7-12(2,3)11(13)14/h9-10H,5-8H2,1-4H3,(H3,13,14) |
| InChIKey | XBZAEZPUYCUBKO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide?
The IUPAC name of 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide (CID 65252117) is 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide is [H]/N=C(\N)C(C)(C)CCN(C)C(C)C1CC1.
What is the InChIKey of 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide?
The InChIKey is XBZAEZPUYCUBKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-9(10-5-6-10)15(4)8-7-12(2,3)11(13)14/h9-10H,5-8H2,1-4H3,(H3,13,14).
What are the key properties of 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide?
4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide has a molecular weight of 211.35 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-cyclopropylethyl(methyl)amino]-2,2-dimethylbutanimidamide is sourced from PubChem (CID 65252117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).