About 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide
4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65252189) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide |
| PubChem CID | 65252189 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCC(O)C1 |
| InChI | InChI=1S/C10H21N3O/c1-10(2,9(11)12)4-6-13-5-3-8(14)7-13/h8,14H,3-7H2,1-2H3,(H3,11,12) |
| InChIKey | KPHMOQRVXJOHOE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide?
The IUPAC name of 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide (CID 65252189) is 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide is [H]/N=C(\N)C(C)(C)CCN1CCC(O)C1.
What is the InChIKey of 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide?
The InChIKey is KPHMOQRVXJOHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c1-10(2,9(11)12)4-6-13-5-3-8(14)7-13/h8,14H,3-7H2,1-2H3,(H3,11,12).
What are the key properties of 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide?
4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide has a molecular weight of 199.30 g/mol, XLogP of 0.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxypyrrolidin-1-yl)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 65252189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).