About [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate (PubChem CID 652523) has the molecular formula C11H9N3O3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate |
| PubChem CID | 652523 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccccn1)Nc1nccs1 |
| InChI | InChI=1S/C11H9N3O3S/c15-9(14-11-13-5-6-18-11)7-17-10(16)8-3-1-2-4-12-8/h1-6H,7H2,(H,13,14,15) |
| InChIKey | CPPDVIPXNQGMJZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate?
The IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate (CID 652523) is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate.
What is the SMILES notation for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate?
The canonical SMILES for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate is O=C(COC(=O)c1ccccn1)Nc1nccs1.
What is the InChIKey of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate?
The InChIKey is CPPDVIPXNQGMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3S/c15-9(14-11-13-5-6-18-11)7-17-10(16)8-3-1-2-4-12-8/h1-6H,7H2,(H,13,14,15).
What are the key properties of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate?
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate has a molecular weight of 263.28 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] pyridine-2-carboxylate is sourced from PubChem (CID 652523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).