C16H25N3 — CID 65252705
2,2-dimethyl-4-(3-phenylpyrrolidin-1-yl)butanimidamide (PubChem CID 65252705) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3-phenylpyrrolidin-1-yl)butanimidamide.
| Compound Name | 2,2-dimethyl-4-(3-phenylpyrrolidin-1-yl)butanimidamide |
|---|---|
| PubChem CID | 65252705 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2,2-dimethyl-4-(3-phenylpyrrolidin-1-yl)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H25N3/c1-16(2,15(17)18)9-11-19-10-8-14(12-19)13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H3,17,18) |
| InChIKey | URTACPWUHPJVHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|