About 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide
4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65252771) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide |
| PubChem CID | 65252771 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C15H22N4/c1-10-7-12-13(8-11(10)2)19(9-18-12)6-5-15(3,4)14(16)17/h7-9H,5-6H2,1-4H3,(H3,16,17) |
| InChIKey | QCJHHAZVFSFOJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide?
The IUPAC name of 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide (CID 65252771) is 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide is [H]/N=C(\N)C(C)(C)CCn1cnc2cc(C)c(C)cc21.
What is the InChIKey of 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide?
The InChIKey is QCJHHAZVFSFOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-10-7-12-13(8-11(10)2)19(9-18-12)6-5-15(3,4)14(16)17/h7-9H,5-6H2,1-4H3,(H3,16,17).
What are the key properties of 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide?
4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide has a molecular weight of 258.37 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 65252771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).