About 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile
4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile (PubChem CID 65252928) has the molecular formula C14H12BrFN2O2
and a molecular weight of 339.16 g/mol. Its IUPAC name is 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
| PubChem CID | 65252928 |
| Molecular Formula | C14H12BrFN2O2 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCN1C(=O)C(=O)c2cc(F)cc(Br)c21 |
| InChI | InChI=1S/C14H12BrFN2O2/c1-14(2,7-17)3-4-18-11-9(12(19)13(18)20)5-8(16)6-10(11)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | ILMFTEOYRPCIIR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile?
The IUPAC name of 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile (CID 65252928) is 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile is CC(C)(C#N)CCN1C(=O)C(=O)c2cc(F)cc(Br)c21.
What is the InChIKey of 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile?
The InChIKey is ILMFTEOYRPCIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrFN2O2/c1-14(2,7-17)3-4-18-11-9(12(19)13(18)20)5-8(16)6-10(11)15/h5-6H,3-4H2,1-2H3.
What are the key properties of 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile?
4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile has a molecular weight of 339.16 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile is sourced from PubChem (CID 65252928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).