C15H30N2 — CID 65253879
2,2-dimethyl-5-(2,4,4-trimethylpentan-2-ylamino)pentanenitrile (PubChem CID 65253879) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2,4,4-trimethylpentan-2-ylamino)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(2,4,4-trimethylpentan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 65253879 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2,2-dimethyl-5-(2,4,4-trimethylpentan-2-ylamino)pentanenitrile |
| SMILES | CC(C)(C)CC(C)(C)NCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H30N2/c1-13(2,3)11-15(6,7)17-10-8-9-14(4,5)12-16/h17H,8-11H2,1-7H3 |
| InChIKey | VUVMYTDFMVPEEK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|