About 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid
5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid (PubChem CID 65255004) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid |
| PubChem CID | 65255004 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid |
| SMILES | Cc1cc(C)n(CCCC(C)(C)C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C13H20N2O3/c1-9-8-10(2)15(12(18)14-9)7-5-6-13(3,4)11(16)17/h8H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | DEJBRWCRPCMFJW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid?
The IUPAC name of 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid (CID 65255004) is 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid.
What is the SMILES notation for 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid?
The canonical SMILES for 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid is Cc1cc(C)n(CCCC(C)(C)C(=O)O)c(=O)n1.
What is the InChIKey of 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid?
The InChIKey is DEJBRWCRPCMFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-9-8-10(2)15(12(18)14-9)7-5-6-13(3,4)11(16)17/h8H,5-7H2,1-4H3,(H,16,17).
What are the key properties of 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid?
5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid has a molecular weight of 252.31 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2,2-dimethylpentanoic acid is sourced from PubChem (CID 65255004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).