About 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine
5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine (PubChem CID 65255758) has the molecular formula C13H20ClNS
and a molecular weight of 257.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine |
| PubChem CID | 65255758 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CN)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClNS/c1-13(2,10-15)8-3-9-16-12-6-4-11(14)5-7-12/h4-7H,3,8-10,15H2,1-2H3 |
| InChIKey | HCACXKIXTBXQMK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine?
The IUPAC name of 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine (CID 65255758) is 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine.
What is the SMILES notation for 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine?
The canonical SMILES for 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine is CC(C)(CN)CCCSc1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine?
The InChIKey is HCACXKIXTBXQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClNS/c1-13(2,10-15)8-3-9-16-12-6-4-11(14)5-7-12/h4-7H,3,8-10,15H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine?
5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine has a molecular weight of 257.83 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)sulfanyl-2,2-dimethylpentan-1-amine is sourced from PubChem (CID 65255758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).