C12H15BrN2O — CID 65255798
5-[(5-bromo-3-pyridinyl)oxy]-2,2-dimethylpentanenitrile (PubChem CID 65255798) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 5-[(5-bromo-3-pyridinyl)oxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[(5-bromo-3-pyridinyl)oxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255798 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-[(5-bromo-3-pyridinyl)oxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1cncc(Br)c1 |
| InChI | InChI=1S/C12H15BrN2O/c1-12(2,9-14)4-3-5-16-11-6-10(13)7-15-8-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | LUSWOAFEYKEHIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|