C11H14F3N3O2 — CID 65256375
2,2-dimethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]butanenitrile (PubChem CID 65256375) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 2,2-dimethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]butanenitrile.
| Compound Name | 2,2-dimethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 65256375 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2,2-dimethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]butanenitrile |
| SMILES | CC(C)(C#N)CCN1C(=O)NC(C)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H14F3N3O2/c1-9(2,6-15)4-5-17-7(18)10(3,11(12,13)14)16-8(17)19/h4-5H2,1-3H3,(H,16,19) |
| InChIKey | DGTOXRNHGFCTPM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|