About 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine
4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine (PubChem CID 65256447) has the molecular formula C9H21NO3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine |
| PubChem CID | 65256447 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine |
| SMILES | COCCS(=O)(=O)CCC(C)(C)CN |
| InChI | InChI=1S/C9H21NO3S/c1-9(2,8-10)4-6-14(11,12)7-5-13-3/h4-8,10H2,1-3H3 |
| InChIKey | KWWUUMMZECBJGQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine?
The IUPAC name of 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine (CID 65256447) is 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine?
The canonical SMILES for 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine is COCCS(=O)(=O)CCC(C)(C)CN.
What is the InChIKey of 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine?
The InChIKey is KWWUUMMZECBJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO3S/c1-9(2,8-10)4-6-14(11,12)7-5-13-3/h4-8,10H2,1-3H3.
What are the key properties of 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine?
4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine has a molecular weight of 223.34 g/mol, XLogP of 0.42, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethylsulfonyl)-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 65256447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).