About 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine
4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine (PubChem CID 65256775) has the molecular formula C11H23NO2S
and a molecular weight of 233.38 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine |
| PubChem CID | 65256775 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CN)CCS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H23NO2S/c1-11(2,9-12)7-8-15(13,14)10-5-3-4-6-10/h10H,3-9,12H2,1-2H3 |
| InChIKey | CZLBGAIDOGPCIO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine?
The IUPAC name of 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine (CID 65256775) is 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine?
The canonical SMILES for 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine is CC(C)(CN)CCS(=O)(=O)C1CCCC1.
What is the InChIKey of 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine?
The InChIKey is CZLBGAIDOGPCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2S/c1-11(2,9-12)7-8-15(13,14)10-5-3-4-6-10/h10H,3-9,12H2,1-2H3.
What are the key properties of 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine?
4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine has a molecular weight of 233.38 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylsulfonyl-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 65256775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).