C23H23ClFN3O5S2 — CID 6525696
4-chloro-3-(diethylsulfamoyl)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 6525696) has the molecular formula C23H23ClFN3O5S2 and a molecular weight of 540.04 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 6525696 |
| Molecular Formula | C23H23ClFN3O5S2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCN2C(=O)S/C(=C\c3ccc(F)cc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H23ClFN3O5S2/c1-3-27(4-2)35(32,33)20-14-16(7-10-18(20)24)21(29)26-11-12-28-22(30)19(34-23(28)31)13-15-5-8-17(25)9-6-15/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,26,29)/b19-13- |
| InChIKey | HSBFVLICCWRWIJ-UYRXBGFRSA-N |
| XLogP | 3.98 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|