C12H16F3N3O2 — CID 65257539
2,2-dimethyl-5-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]pentanenitrile (PubChem CID 65257539) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]pentanenitrile.
| Compound Name | 2,2-dimethyl-5-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 65257539 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2,2-dimethyl-5-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]pentanenitrile |
| SMILES | CC(C)(C#N)CCCN1C(=O)NC(C)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H16F3N3O2/c1-10(2,7-16)5-4-6-18-8(19)11(3,12(13,14)15)17-9(18)20/h4-6H2,1-3H3,(H,17,20) |
| InChIKey | NDNZTHNDAWKEEW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|