About 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide
5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide (PubChem CID 65258590) has the molecular formula C13H19FN2O
and a molecular weight of 238.31 g/mol. Its IUPAC name is 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide.
Molecular Properties
| Compound Name | 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide |
| PubChem CID | 65258590 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOc1ccccc1F |
| InChI | InChI=1S/C13H19FN2O/c1-13(2,12(15)16)8-5-9-17-11-7-4-3-6-10(11)14/h3-4,6-7H,5,8-9H2,1-2H3,(H3,15,16) |
| InChIKey | XUQVKJIZDWGJGT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide?
The IUPAC name of 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide (CID 65258590) is 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide.
What is the SMILES notation for 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide?
The canonical SMILES for 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide is [H]/N=C(\N)C(C)(C)CCCOc1ccccc1F.
What is the InChIKey of 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide?
The InChIKey is XUQVKJIZDWGJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O/c1-13(2,12(15)16)8-5-9-17-11-7-4-3-6-10(11)14/h3-4,6-7H,5,8-9H2,1-2H3,(H3,15,16).
What are the key properties of 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide?
5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide has a molecular weight of 238.31 g/mol, XLogP of 2.95, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenoxy)-2,2-dimethylpentanimidamide is sourced from PubChem (CID 65258590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).